About naphthalene-1,4-dione;1-nitroanthracene
naphthalene-1,4-dione;1-nitroanthracene (PubChem CID 174918001) has the molecular formula C24H15NO4
and a molecular weight of 381.39 g/mol. Its IUPAC name is naphthalene-1,4-dione;1-nitroanthracene.
Molecular Properties
| Compound Name | naphthalene-1,4-dione;1-nitroanthracene |
| PubChem CID | 174918001 |
| Molecular Formula | C24H15NO4 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | naphthalene-1,4-dione;1-nitroanthracene |
| SMILES | O=C1C=CC(=O)c2ccccc21.O=[N+]([O-])c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C14H9NO2.C10H6O2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-9H;1-6H |
| InChIKey | VYUGBNXULOOMHB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,4-dione;1-nitroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,4-dione;1-nitroanthracene?
The IUPAC name of naphthalene-1,4-dione;1-nitroanthracene (CID 174918001) is naphthalene-1,4-dione;1-nitroanthracene.
What is the SMILES notation for naphthalene-1,4-dione;1-nitroanthracene?
The canonical SMILES for naphthalene-1,4-dione;1-nitroanthracene is O=C1C=CC(=O)c2ccccc21.O=[N+]([O-])c1cccc2cc3ccccc3cc12.
What is the InChIKey of naphthalene-1,4-dione;1-nitroanthracene?
The InChIKey is VYUGBNXULOOMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO2.C10H6O2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-9H;1-6H.
What are the key properties of naphthalene-1,4-dione;1-nitroanthracene?
naphthalene-1,4-dione;1-nitroanthracene has a molecular weight of 381.39 g/mol, XLogP of 5.52, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,4-dione;1-nitroanthracene is sourced from PubChem (CID 174918001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).