About 2,3-dinitrohexacene
2,3-dinitrohexacene (PubChem CID 101108857) has the molecular formula C26H14N2O4
and a molecular weight of 418.41 g/mol. Its IUPAC name is 2,3-dinitrohexacene.
Molecular Properties
| Compound Name | 2,3-dinitrohexacene |
| PubChem CID | 101108857 |
| Molecular Formula | C26H14N2O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2,3-dinitrohexacene |
| SMILES | O=[N+]([O-])c1cc2cc3cc4cc5cc6ccccc6cc5cc4cc3cc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H14N2O4/c29-27(30)25-13-23-11-21-9-19-7-17-5-15-3-1-2-4-16(15)6-18(17)8-20(19)10-22(21)12-24(23)14-26(25)28(31)32/h1-14H |
| InChIKey | YCQAINLDTOFIAZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dinitrohexacene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dinitrohexacene?
The IUPAC name of 2,3-dinitrohexacene (CID 101108857) is 2,3-dinitrohexacene.
What is the SMILES notation for 2,3-dinitrohexacene?
The canonical SMILES for 2,3-dinitrohexacene is O=[N+]([O-])c1cc2cc3cc4cc5cc6ccccc6cc5cc4cc3cc2cc1[N+](=O)[O-].
What is the InChIKey of 2,3-dinitrohexacene?
The InChIKey is YCQAINLDTOFIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H14N2O4/c29-27(30)25-13-23-11-21-9-19-7-17-5-15-3-1-2-4-16(15)6-18(17)8-20(19)10-22(21)12-24(23)14-26(25)28(31)32/h1-14H.
What are the key properties of 2,3-dinitrohexacene?
2,3-dinitrohexacene has a molecular weight of 418.41 g/mol, XLogP of 7.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dinitrohexacene is sourced from PubChem (CID 101108857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).