About benzene-1,4-diamine;1-nitrotetracene
benzene-1,4-diamine;1-nitrotetracene (PubChem CID 157077126) has the molecular formula C24H19N3O2
and a molecular weight of 381.44 g/mol. Its IUPAC name is benzene-1,4-diamine;1-nitrotetracene.
Molecular Properties
| Compound Name | benzene-1,4-diamine;1-nitrotetracene |
| PubChem CID | 157077126 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | benzene-1,4-diamine;1-nitrotetracene |
| SMILES | Nc1ccc(N)cc1.O=[N+]([O-])c1cccc2cc3cc4ccccc4cc3cc12 |
| InChI | InChI=1S/C18H11NO2.C6H8N2/c20-19(21)18-7-3-6-14-10-15-8-12-4-1-2-5-13(12)9-16(15)11-17(14)18;7-5-1-2-6(8)4-3-5/h1-11H;1-4H,7-8H2 |
| InChIKey | ADCGBRQOXVWIEN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,4-diamine;1-nitrotetracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,4-diamine;1-nitrotetracene?
The IUPAC name of benzene-1,4-diamine;1-nitrotetracene (CID 157077126) is benzene-1,4-diamine;1-nitrotetracene.
What is the SMILES notation for benzene-1,4-diamine;1-nitrotetracene?
The canonical SMILES for benzene-1,4-diamine;1-nitrotetracene is Nc1ccc(N)cc1.O=[N+]([O-])c1cccc2cc3cc4ccccc4cc3cc12.
What is the InChIKey of benzene-1,4-diamine;1-nitrotetracene?
The InChIKey is ADCGBRQOXVWIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO2.C6H8N2/c20-19(21)18-7-3-6-14-10-15-8-12-4-1-2-5-13(12)9-16(15)11-17(14)18;7-5-1-2-6(8)4-3-5/h1-11H;1-4H,7-8H2.
What are the key properties of benzene-1,4-diamine;1-nitrotetracene?
benzene-1,4-diamine;1-nitrotetracene has a molecular weight of 381.44 g/mol, XLogP of 5.91, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,4-diamine;1-nitrotetracene is sourced from PubChem (CID 157077126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).