About tripotassium;tetracene;borate
tripotassium;tetracene;borate (PubChem CID 158896601) has the molecular formula C18H12BK3O3
and a molecular weight of 404.40 g/mol. Its IUPAC name is tripotassium;tetracene;borate.
Molecular Properties
| Compound Name | tripotassium;tetracene;borate |
| PubChem CID | 158896601 |
| Molecular Formula | C18H12BK3O3 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | tripotassium;tetracene;borate |
| SMILES | [K+].[K+].[K+].[O-]B([O-])[O-].c1ccc2cc3cc4ccccc4cc3cc2c1 |
| InChI | InChI=1S/C18H12.BO3.3K/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1;2-1(3)4;;;/h1-12H;;;;/q;-3;3*+1 |
| InChIKey | JEXGTYZIDROTBQ-UHFFFAOYSA-N |
| XLogP | -7.79 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | -7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;tetracene;borate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;tetracene;borate?
The IUPAC name of tripotassium;tetracene;borate (CID 158896601) is tripotassium;tetracene;borate.
What is the SMILES notation for tripotassium;tetracene;borate?
The canonical SMILES for tripotassium;tetracene;borate is [K+].[K+].[K+].[O-]B([O-])[O-].c1ccc2cc3cc4ccccc4cc3cc2c1.
What is the InChIKey of tripotassium;tetracene;borate?
The InChIKey is JEXGTYZIDROTBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12.BO3.3K/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1;2-1(3)4;;;/h1-12H;;;;/q;-3;3*+1.
What are the key properties of tripotassium;tetracene;borate?
tripotassium;tetracene;borate has a molecular weight of 404.40 g/mol, XLogP of -7.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;tetracene;borate is sourced from PubChem (CID 158896601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).