C10H5N3O6 — CID 22719066
1,2,3-trinitronaphthalene (PubChem CID 22719066) has the molecular formula C10H5N3O6 and a molecular weight of 263.17 g/mol. Its IUPAC name is 1,2,3-trinitronaphthalene.
| Compound Name | 1,2,3-trinitronaphthalene |
|---|---|
| PubChem CID | 22719066 |
| Molecular Formula | C10H5N3O6 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | 1,2,3-trinitronaphthalene |
| SMILES | O=[N+]([O-])c1cc2ccccc2c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H5N3O6/c14-11(15)8-5-6-3-1-2-4-7(6)9(12(16)17)10(8)13(18)19/h1-5H |
| InChIKey | XTJFYLJRCWKLBB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|