About gold;naphthalene-1,4-dione
gold;naphthalene-1,4-dione (PubChem CID 159229238) has the molecular formula C10H6AuO2
and a molecular weight of 355.12 g/mol. Its IUPAC name is gold;naphthalene-1,4-dione.
Molecular Properties
| Compound Name | gold;naphthalene-1,4-dione |
| PubChem CID | 159229238 |
| Molecular Formula | C10H6AuO2 |
| Molecular Weight | 355.12 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | gold;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)c2ccccc21.[Au] |
| InChI | InChI=1S/C10H6O2.Au/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;/h1-6H; |
| InChIKey | KSRJSNMBKTYJOQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze gold;naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;naphthalene-1,4-dione?
The IUPAC name of gold;naphthalene-1,4-dione (CID 159229238) is gold;naphthalene-1,4-dione.
What is the SMILES notation for gold;naphthalene-1,4-dione?
The canonical SMILES for gold;naphthalene-1,4-dione is O=C1C=CC(=O)c2ccccc21.[Au].
What is the InChIKey of gold;naphthalene-1,4-dione?
The InChIKey is KSRJSNMBKTYJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2.Au/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;/h1-6H;.
What are the key properties of gold;naphthalene-1,4-dione?
gold;naphthalene-1,4-dione has a molecular weight of 355.12 g/mol, XLogP of 1.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold;naphthalene-1,4-dione is sourced from PubChem (CID 159229238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).