About hydron;naphthalene-1,4-dione
hydron;naphthalene-1,4-dione (PubChem CID 174880921) has the molecular formula C10H7O2+
and a molecular weight of 159.16 g/mol. Its IUPAC name is hydron;naphthalene-1,4-dione.
Molecular Properties
| Compound Name | hydron;naphthalene-1,4-dione |
| PubChem CID | 174880921 |
| Molecular Formula | C10H7O2+ |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | hydron;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)c2ccccc21.[H+] |
| InChI | InChI=1S/C10H6O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H/p+1 |
| InChIKey | FRASJONUBLZVQX-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze hydron;naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;naphthalene-1,4-dione?
The IUPAC name of hydron;naphthalene-1,4-dione (CID 174880921) is hydron;naphthalene-1,4-dione.
What is the SMILES notation for hydron;naphthalene-1,4-dione?
The canonical SMILES for hydron;naphthalene-1,4-dione is O=C1C=CC(=O)c2ccccc21.[H+].
What is the InChIKey of hydron;naphthalene-1,4-dione?
The InChIKey is FRASJONUBLZVQX-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H6O2/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H/p+1.
What are the key properties of hydron;naphthalene-1,4-dione?
hydron;naphthalene-1,4-dione has a molecular weight of 159.16 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;naphthalene-1,4-dione is sourced from PubChem (CID 174880921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).