About naphthalene-1,4-dione;phenylmethoxymethylbenzene
naphthalene-1,4-dione;phenylmethoxymethylbenzene (PubChem CID 67613477) has the molecular formula C24H20O3
and a molecular weight of 356.42 g/mol. Its IUPAC name is naphthalene-1,4-dione;phenylmethoxymethylbenzene.
Molecular Properties
| Compound Name | naphthalene-1,4-dione;phenylmethoxymethylbenzene |
| PubChem CID | 67613477 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | naphthalene-1,4-dione;phenylmethoxymethylbenzene |
| SMILES | O=C1C=CC(=O)c2ccccc21.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14O.C10H6O2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-10H,11-12H2;1-6H |
| InChIKey | QLYOCQPHVVOXIW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,4-dione;phenylmethoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,4-dione;phenylmethoxymethylbenzene?
The IUPAC name of naphthalene-1,4-dione;phenylmethoxymethylbenzene (CID 67613477) is naphthalene-1,4-dione;phenylmethoxymethylbenzene.
What is the SMILES notation for naphthalene-1,4-dione;phenylmethoxymethylbenzene?
The canonical SMILES for naphthalene-1,4-dione;phenylmethoxymethylbenzene is O=C1C=CC(=O)c2ccccc21.c1ccc(COCc2ccccc2)cc1.
What is the InChIKey of naphthalene-1,4-dione;phenylmethoxymethylbenzene?
The InChIKey is QLYOCQPHVVOXIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C10H6O2/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-10H,11-12H2;1-6H.
What are the key properties of naphthalene-1,4-dione;phenylmethoxymethylbenzene?
naphthalene-1,4-dione;phenylmethoxymethylbenzene has a molecular weight of 356.42 g/mol, XLogP of 5.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,4-dione;phenylmethoxymethylbenzene is sourced from PubChem (CID 67613477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).