C16H12N12O14 — CID 139147480
(3S,5R,9S,11R)-2,4,6,8,10,12-hexanitro-2,4,6,8,10,12-hexazatetracyclo[5.5.0.03,11.05,9]dodecane;naphthalene-1,4-dione (PubChem CID 139147480) has the molecular formula C16H12N12O14 and a molecular weight of 596.34 g/mol. Its IUPAC name is (3S,5R,9S,11R)-2,4,6,8,10,12-hexanitro-2,4,6,8,10,12-hexazatetracyclo[5.5.0.03,11.05,9]dodecane;naphthalene-1,4-dione.
| Compound Name | (3S,5R,9S,11R)-2,4,6,8,10,12-hexanitro-2,4,6,8,10,12-hexazatetracyclo[5.5.0.03,11.05,9]dodecane;naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139147480 |
| Molecular Formula | C16H12N12O14 |
| Molecular Weight | 596.34 g/mol |
| Exact Mass | 596.06 |
| IUPAC Name | (3S,5R,9S,11R)-2,4,6,8,10,12-hexanitro-2,4,6,8,10,12-hexazatetracyclo[5.5.0.03,11.05,9]dodecane;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)c2ccccc21.O=[N+]([O-])N1C2C3N([N+](=O)[O-])[C@H]4[C@@H](N3[N+](=O)[O-])N([N+](=O)[O-])[C@@H]1[C@@H](N2[N+](=O)[O-])N4[N+](=O)[O-] |
| InChI | InChI=1S/C10H6O2.C6H6N12O12/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;19-13(20)7-1-2-8(14(21)22)5(7)6-9(15(23)24)3(11(1)17(27)28)4(10(6)16(25)26)12(2)18(29)30/h1-6H;1-6H/t;1-,2+,3+,4-,5?,6? |
| InChIKey | ZPLZQEDMRBBCMB-QNEKEQHPSA-N |
| XLogP | -2.42 |
| TPSA | 312.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.34 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|