About 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione
4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione (PubChem CID 158641233) has the molecular formula C20H14O4
and a molecular weight of 318.33 g/mol. Its IUPAC name is 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione.
Molecular Properties
| Compound Name | 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione |
| PubChem CID | 158641233 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)C2C=CC=CC12.O=C1C=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H8O2.C10H6O2/c2*11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-8H;1-6H |
| InChIKey | IAKIBTGNRQTZEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione?
The IUPAC name of 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione (CID 158641233) is 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione.
What is the SMILES notation for 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione?
The canonical SMILES for 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione is O=C1C=CC(=O)C2C=CC=CC12.O=C1C=CC(=O)c2ccccc21.
What is the InChIKey of 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione?
The InChIKey is IAKIBTGNRQTZEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C10H6O2/c2*11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-8H;1-6H.
What are the key properties of 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione?
4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione has a molecular weight of 318.33 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione is sourced from PubChem (CID 158641233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).