C20H14O4 — CID 158641233
4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione (PubChem CID 158641233) has the molecular formula C20H14O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione.
| Compound Name | 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione |
|---|---|
| PubChem CID | 158641233 |
| Molecular Formula | C20H14O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4a,8a-dihydronaphthalene-1,4-dione;naphthalene-1,4-dione |
| SMILES | O=C1C=CC(=O)C2C=CC=CC12.O=C1C=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H8O2.C10H6O2/c2*11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-8H;1-6H |
| InChIKey | IAKIBTGNRQTZEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|