C18H22O2 — CID 90920478
4a,9a-dihydroanthracene-9,10-dione;ethane (PubChem CID 90920478) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4a,9a-dihydroanthracene-9,10-dione;ethane.
| Compound Name | 4a,9a-dihydroanthracene-9,10-dione;ethane |
|---|---|
| PubChem CID | 90920478 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4a,9a-dihydroanthracene-9,10-dione;ethane |
| SMILES | CC.CC.O=C1c2ccccc2C(=O)C2C=CC=CC12 |
| InChI | InChI=1S/C14H10O2.2C2H6/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;2*1-2/h1-10H;2*1-2H3 |
| InChIKey | ODBKEKKDXNAOET-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|