C14H11NO3 — CID 163860417
1-aminooxy-4a,9a-dihydroanthracene-9,10-dione (PubChem CID 163860417) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-aminooxy-4a,9a-dihydroanthracene-9,10-dione.
| Compound Name | 1-aminooxy-4a,9a-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 163860417 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-aminooxy-4a,9a-dihydroanthracene-9,10-dione |
| SMILES | NOC1=CC=CC2C(=O)c3ccccc3C(=O)C12 |
| InChI | InChI=1S/C14H11NO3/c15-18-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7,10,12H,15H2 |
| InChIKey | PCACOSIODCJJJA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|