C15H9O2Tl — CID 134863179
(8,10-dioxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl)thallium (PubChem CID 134863179) has the molecular formula C15H9O2Tl and a molecular weight of 425.62 g/mol. Its IUPAC name is (8,10-dioxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl)thallium.
| Compound Name | (8,10-dioxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl)thallium |
|---|---|
| PubChem CID | 134863179 |
| Molecular Formula | C15H9O2Tl |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | (8,10-dioxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaenyl)thallium |
| SMILES | O=C1c2ccccc2-c2ccccc2C(=O)C1[Tl] |
| InChI | InChI=1S/C15H9O2.Tl/c16-14-9-15(17)13-8-4-2-6-11(13)10-5-1-3-7-12(10)14;/h1-9H; |
| InChIKey | VRMXJJWIALSHCZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|