C14H12O2 — CID 98115769
(4aS,9aS)-1,4,4a,9a-tetrahydroanthracene-9,10-dione (PubChem CID 98115769) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (4aS,9aS)-1,4,4a,9a-tetrahydroanthracene-9,10-dione.
| Compound Name | (4aS,9aS)-1,4,4a,9a-tetrahydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 98115769 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (4aS,9aS)-1,4,4a,9a-tetrahydroanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)[C@H]2CC=CC[C@H]12 |
| InChI | InChI=1S/C14H12O2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-6,11-12H,7-8H2/t11-,12-/m0/s1 |
| InChIKey | XPCZSIPRUSOJFO-RYUDHWBXSA-N |
| XLogP | 2.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|