C18H13ClO3 — CID 4028380
6-chloro-11-hydroxy-1,4,4a,12a-tetrahydrotetracene-5,12-dione (PubChem CID 4028380) has the molecular formula C18H13ClO3 and a molecular weight of 312.75 g/mol. Its IUPAC name is 6-chloro-11-hydroxy-1,4,4a,12a-tetrahydrotetracene-5,12-dione.
| Compound Name | 6-chloro-11-hydroxy-1,4,4a,12a-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 4028380 |
| Molecular Formula | C18H13ClO3 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 6-chloro-11-hydroxy-1,4,4a,12a-tetrahydrotetracene-5,12-dione |
| SMILES | O=C1c2c(c(Cl)c3ccccc3c2O)C(=O)C2CC=CCC12 |
| InChI | InChI=1S/C18H13ClO3/c19-15-9-5-1-2-6-10(9)17(21)14-13(15)16(20)11-7-3-4-8-12(11)18(14)22/h1-6,11-12,21H,7-8H2 |
| InChIKey | BCQJUUDWYRSWHD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|