C20H12O4S2 — CID 98085181
(1S,3R,12S,14S)-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-5,7,9,16,18,20-hexaene-4,11,15,22-tetrone (PubChem CID 98085181) has the molecular formula C20H12O4S2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (1S,3R,12S,14S)-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-5,7,9,16,18,20-hexaene-4,11,15,22-tetrone.
| Compound Name | (1S,3R,12S,14S)-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-5,7,9,16,18,20-hexaene-4,11,15,22-tetrone |
|---|---|
| PubChem CID | 98085181 |
| Molecular Formula | C20H12O4S2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (1S,3R,12S,14S)-2,13-dithiapentacyclo[12.8.0.03,12.05,10.016,21]docosa-5,7,9,16,18,20-hexaene-4,11,15,22-tetrone |
| SMILES | O=C1c2ccccc2C(=O)[C@@H]2S[C@H]3C(=O)c4ccccc4C(=O)[C@@H]3S[C@H]12 |
| InChI | InChI=1S/C20H12O4S2/c21-13-9-5-1-2-6-10(9)14(22)18-17(13)25-19-15(23)11-7-3-4-8-12(11)16(24)20(19)26-18/h1-8,17-20H/t17-,18-,19-,20+/m0/s1 |
| InChIKey | BQPAVUCZTHBGEU-LWYYNNOASA-N |
| XLogP | 3.10 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|