C14H12O2S4 — CID 134868606
(4aS,10aR)-2,3-bis(methylsulfanyl)-4a,10a-dihydrobenzo[g][1,4]benzodithiine-5,10-dione (PubChem CID 134868606) has the molecular formula C14H12O2S4 and a molecular weight of 340.52 g/mol. Its IUPAC name is (4aS,10aR)-2,3-bis(methylsulfanyl)-4a,10a-dihydrobenzo[g][1,4]benzodithiine-5,10-dione.
| Compound Name | (4aS,10aR)-2,3-bis(methylsulfanyl)-4a,10a-dihydrobenzo[g][1,4]benzodithiine-5,10-dione |
|---|---|
| PubChem CID | 134868606 |
| Molecular Formula | C14H12O2S4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | (4aS,10aR)-2,3-bis(methylsulfanyl)-4a,10a-dihydrobenzo[g][1,4]benzodithiine-5,10-dione |
| SMILES | CSC1=C(SC)S[C@H]2C(=O)c3ccccc3C(=O)[C@H]2S1 |
| InChI | InChI=1S/C14H12O2S4/c1-17-13-14(18-2)20-12-10(16)8-6-4-3-5-7(8)9(15)11(12)19-13/h3-6,11-12H,1-2H3/t11-,12+ |
| InChIKey | UACDBCWJYOPDOM-TXEJJXNPSA-N |
| XLogP | 4.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|