C14H10O2S4 — CID 2332991
2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]indene-1,3-dione (PubChem CID 2332991) has the molecular formula C14H10O2S4 and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]indene-1,3-dione.
| Compound Name | 2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 2332991 |
| Molecular Formula | C14H10O2S4 |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 2-[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]indene-1,3-dione |
| SMILES | CSC1=C(SC)SC(=C2C(=O)c3ccccc3C2=O)S1 |
| InChI | InChI=1S/C14H10O2S4/c1-17-13-14(18-2)20-12(19-13)9-10(15)7-5-3-4-6-8(7)11(9)16/h3-6H,1-2H3 |
| InChIKey | YUSSLPUXPSXFIR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|