C14H6O5 — CID 68577943
anthracene-1,2,4,9,10-pentone (PubChem CID 68577943) has the molecular formula C14H6O5 and a molecular weight of 254.20 g/mol. Its IUPAC name is anthracene-1,2,4,9,10-pentone.
| Compound Name | anthracene-1,2,4,9,10-pentone |
|---|---|
| PubChem CID | 68577943 |
| Molecular Formula | C14H6O5 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | anthracene-1,2,4,9,10-pentone |
| SMILES | O=C1CC(=O)C2=C(C1=O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H6O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-4H,5H2 |
| InChIKey | REYDKQTUFMZOQS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|