C14H9NO4 — CID 150709096
4-amino-4H-anthracene-1,3,9,10-tetrone (PubChem CID 150709096) has the molecular formula C14H9NO4 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-amino-4H-anthracene-1,3,9,10-tetrone.
| Compound Name | 4-amino-4H-anthracene-1,3,9,10-tetrone |
|---|---|
| PubChem CID | 150709096 |
| Molecular Formula | C14H9NO4 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-amino-4H-anthracene-1,3,9,10-tetrone |
| SMILES | NC1C(=O)CC(=O)C2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H9NO4/c15-12-9(17)5-8(16)10-11(12)14(19)7-4-2-1-3-6(7)13(10)18/h1-4,12H,5,15H2 |
| InChIKey | JNMNVJGNFZUAKJ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|