C24H24O2 — CID 142748986
2-cyclooctyl-3-phenylnaphthalene-1,4-dione (PubChem CID 142748986) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-cyclooctyl-3-phenylnaphthalene-1,4-dione.
| Compound Name | 2-cyclooctyl-3-phenylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 142748986 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-cyclooctyl-3-phenylnaphthalene-1,4-dione |
| SMILES | O=C1C(c2ccccc2)=C(C2CCCCCCC2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H24O2/c25-23-19-15-9-10-16-20(19)24(26)22(18-13-7-4-8-14-18)21(23)17-11-5-2-1-3-6-12-17/h4,7-10,13-17H,1-3,5-6,11-12H2 |
| InChIKey | IJHVLONSTMBRAH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|