C18H20O3 — CID 10636798
2-[4-(hydroxymethyl)cyclohexyl]-3-methylnaphthalene-1,4-dione (PubChem CID 10636798) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)cyclohexyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[4-(hydroxymethyl)cyclohexyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10636798 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[4-(hydroxymethyl)cyclohexyl]-3-methylnaphthalene-1,4-dione |
| SMILES | CC1=C(C2CCC(CO)CC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H20O3/c1-11-16(13-8-6-12(10-19)7-9-13)18(21)15-5-3-2-4-14(15)17(11)20/h2-5,12-13,19H,6-10H2,1H3 |
| InChIKey | HEYWZVXESCDCJL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|