About (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid
(3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid (PubChem CID 25197329) has the molecular formula C11H9BO4
and a molecular weight of 216.00 g/mol. Its IUPAC name is (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid.
Molecular Properties
| Compound Name | (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid |
| PubChem CID | 25197329 |
| Molecular Formula | C11H9BO4 |
| Molecular Weight | 216.00 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid |
| SMILES | CC1=C(B(O)O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H9BO4/c1-6-9(12(15)16)11(14)8-5-3-2-4-7(8)10(6)13/h2-5,15-16H,1H3 |
| InChIKey | YGYRRALMIUETRN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.00 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid?
The IUPAC name of (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid (CID 25197329) is (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid.
What is the SMILES notation for (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid?
The canonical SMILES for (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid is CC1=C(B(O)O)C(=O)c2ccccc2C1=O.
What is the InChIKey of (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid?
The InChIKey is YGYRRALMIUETRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BO4/c1-6-9(12(15)16)11(14)8-5-3-2-4-7(8)10(6)13/h2-5,15-16H,1H3.
What are the key properties of (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid?
(3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid has a molecular weight of 216.00 g/mol, XLogP of 0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,4-dioxonaphthalen-2-yl)boronic acid is sourced from PubChem (CID 25197329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).