C17H12O3S — CID 102099978
2-(2-hydroxyphenyl)sulfanyl-3-methylnaphthalene-1,4-dione (PubChem CID 102099978) has the molecular formula C17H12O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)sulfanyl-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-(2-hydroxyphenyl)sulfanyl-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 102099978 |
| Molecular Formula | C17H12O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-(2-hydroxyphenyl)sulfanyl-3-methylnaphthalene-1,4-dione |
| SMILES | CC1=C(Sc2ccccc2O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12O3S/c1-10-15(19)11-6-2-3-7-12(11)16(20)17(10)21-14-9-5-4-8-13(14)18/h2-9,18H,1H3 |
| InChIKey | OFMZANQLHQZNBV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|