C22H29ClO2 — CID 143871807
2-(4-tert-butylcyclohexyl)-3-chloronaphthalene-1,4-dione;ethane (PubChem CID 143871807) has the molecular formula C22H29ClO2 and a molecular weight of 360.93 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)-3-chloronaphthalene-1,4-dione;ethane.
| Compound Name | 2-(4-tert-butylcyclohexyl)-3-chloronaphthalene-1,4-dione;ethane |
|---|---|
| PubChem CID | 143871807 |
| Molecular Formula | C22H29ClO2 |
| Molecular Weight | 360.93 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)-3-chloronaphthalene-1,4-dione;ethane |
| SMILES | CC.CC(C)(C)C1CCC(C2=C(Cl)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C20H23ClO2.C2H6/c1-20(2,3)13-10-8-12(9-11-13)16-17(21)19(23)15-7-5-4-6-14(15)18(16)22;1-2/h4-7,12-13H,8-11H2,1-3H3;1-2H3 |
| InChIKey | QCLRYJBYZTXUQC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.93 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|