C21H23ClO2 — CID 169227950
2-[(4-tert-butylcyclohexen-1-yl)methyl]-3-chloronaphthalene-1,4-dione (PubChem CID 169227950) has the molecular formula C21H23ClO2 and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-[(4-tert-butylcyclohexen-1-yl)methyl]-3-chloronaphthalene-1,4-dione.
| Compound Name | 2-[(4-tert-butylcyclohexen-1-yl)methyl]-3-chloronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 169227950 |
| Molecular Formula | C21H23ClO2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-[(4-tert-butylcyclohexen-1-yl)methyl]-3-chloronaphthalene-1,4-dione |
| SMILES | CC(C)(C)C1CC=C(CC2=C(Cl)C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C21H23ClO2/c1-21(2,3)14-10-8-13(9-11-14)12-17-18(22)20(24)16-7-5-4-6-15(16)19(17)23/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | GTQMFPDGKYXMJE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|