C24H14Cl2O4 — CID 139785695
2-chloro-3-[4-(3-chloro-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione (PubChem CID 139785695) has the molecular formula C24H14Cl2O4 and a molecular weight of 437.28 g/mol. Its IUPAC name is 2-chloro-3-[4-(3-chloro-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[4-(3-chloro-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139785695 |
| Molecular Formula | C24H14Cl2O4 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | 2-chloro-3-[4-(3-chloro-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(CC=CCC2=C(Cl)C(=O)c3ccccc3C2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C24H14Cl2O4/c25-19-17(21(27)13-7-1-3-9-15(13)23(19)29)11-5-6-12-18-20(26)24(30)16-10-4-2-8-14(16)22(18)28/h1-10H,11-12H2 |
| InChIKey | KDMCSBKJVBYLRE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|