C17H10Cl2O2S — CID 56649501
2-chloro-3-[(4-chlorophenyl)methylsulfanyl]naphthalene-1,4-dione (PubChem CID 56649501) has the molecular formula C17H10Cl2O2S and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-chloro-3-[(4-chlorophenyl)methylsulfanyl]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[(4-chlorophenyl)methylsulfanyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 56649501 |
| Molecular Formula | C17H10Cl2O2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | 2-chloro-3-[(4-chlorophenyl)methylsulfanyl]naphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=C(SCc2ccc(Cl)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H10Cl2O2S/c18-11-7-5-10(6-8-11)9-22-17-14(19)15(20)12-3-1-2-4-13(12)16(17)21/h1-8H,9H2 |
| InChIKey | KHVUQOZLYSKFPV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|