About copper bis(2-chloro-3,4-dioxonaphthalen-1-olate)
copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) (PubChem CID 102196956) has the molecular formula C20H8Cl2CuO6
and a molecular weight of 478.73 g/mol. Its IUPAC name is copper bis(2-chloro-3,4-dioxonaphthalen-1-olate).
Molecular Properties
| Compound Name | copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) |
| PubChem CID | 102196956 |
| Molecular Formula | C20H8Cl2CuO6 |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 476.90 |
| IUPAC Name | copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) |
| SMILES | O=C1C(=O)c2ccccc2C([O-])=C1Cl.O=C1C(=O)c2ccccc2C([O-])=C1Cl.[Cu+2] |
| InChI | InChI=1S/2C10H5ClO3.Cu/c2*11-7-8(12)5-3-1-2-4-6(5)9(13)10(7)14;/h2*1-4,12H;/q;;+2/p-2 |
| InChIKey | JPVIUASANDNSSC-UHFFFAOYSA-L |
| XLogP | 1.44 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(2-chloro-3,4-dioxonaphthalen-1-olate)?
The IUPAC name of copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) (CID 102196956) is copper bis(2-chloro-3,4-dioxonaphthalen-1-olate).
What is the SMILES notation for copper bis(2-chloro-3,4-dioxonaphthalen-1-olate)?
The canonical SMILES for copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) is O=C1C(=O)c2ccccc2C([O-])=C1Cl.O=C1C(=O)c2ccccc2C([O-])=C1Cl.[Cu+2].
What is the InChIKey of copper bis(2-chloro-3,4-dioxonaphthalen-1-olate)?
The InChIKey is JPVIUASANDNSSC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H5ClO3.Cu/c2*11-7-8(12)5-3-1-2-4-6(5)9(13)10(7)14;/h2*1-4,12H;/q;;+2/p-2.
What are the key properties of copper bis(2-chloro-3,4-dioxonaphthalen-1-olate)?
copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) has a molecular weight of 478.73 g/mol, XLogP of 1.44, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(2-chloro-3,4-dioxonaphthalen-1-olate) is sourced from PubChem (CID 102196956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).