C13H9BrO3 — CID 135037634
2-[3-(bromomethyl)-1,4-dioxonaphthalen-2-yl]acetaldehyde (PubChem CID 135037634) has the molecular formula C13H9BrO3 and a molecular weight of 293.12 g/mol. Its IUPAC name is 2-[3-(bromomethyl)-1,4-dioxonaphthalen-2-yl]acetaldehyde.
| Compound Name | 2-[3-(bromomethyl)-1,4-dioxonaphthalen-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 135037634 |
| Molecular Formula | C13H9BrO3 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2-[3-(bromomethyl)-1,4-dioxonaphthalen-2-yl]acetaldehyde |
| SMILES | O=CCC1=C(CBr)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H9BrO3/c14-7-11-10(5-6-15)12(16)8-3-1-2-4-9(8)13(11)17/h1-4,6H,5,7H2 |
| InChIKey | SAUFUTNULNMKCV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|