C28H24O6 — CID 139785684
2-ethoxy-3-[4-(3-ethoxy-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione (PubChem CID 139785684) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-ethoxy-3-[4-(3-ethoxy-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione.
| Compound Name | 2-ethoxy-3-[4-(3-ethoxy-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139785684 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-ethoxy-3-[4-(3-ethoxy-1,4-dioxonaphthalen-2-yl)but-2-enyl]naphthalene-1,4-dione |
| SMILES | CCOC1=C(CC=CCC2=C(OCC)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H24O6/c1-3-33-27-21(23(29)17-11-5-7-13-19(17)25(27)31)15-9-10-16-22-24(30)18-12-6-8-14-20(18)26(32)28(22)34-4-2/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | KJFJUBKLZOLFFQ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|