C30H28O6 — CID 139785685
2-ethoxy-3-[2-(3-ethoxy-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione (PubChem CID 139785685) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is 2-ethoxy-3-[2-(3-ethoxy-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione.
| Compound Name | 2-ethoxy-3-[2-(3-ethoxy-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139785685 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-ethoxy-3-[2-(3-ethoxy-1,4-dioxonaphthalen-2-yl)cyclohexyl]naphthalene-1,4-dione |
| SMILES | CCOC1=C(C2CCCCC2C2=C(OCC)C(=O)c3ccccc3C2=O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H28O6/c1-3-35-29-23(25(31)19-13-7-9-15-21(19)27(29)33)17-11-5-6-12-18(17)24-26(32)20-14-8-10-16-22(20)28(34)30(24)36-4-2/h7-10,13-18H,3-6,11-12H2,1-2H3 |
| InChIKey | GRAFOHYHWCGTAB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|