C24H36O3Sn — CID 15174825
2-ethoxy-3-tributylstannylnaphthalene-1,4-dione (PubChem CID 15174825) has the molecular formula C24H36O3Sn and a molecular weight of 491.26 g/mol. Its IUPAC name is 2-ethoxy-3-tributylstannylnaphthalene-1,4-dione.
| Compound Name | 2-ethoxy-3-tributylstannylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 15174825 |
| Molecular Formula | C24H36O3Sn |
| Molecular Weight | 491.26 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 2-ethoxy-3-tributylstannylnaphthalene-1,4-dione |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=C(OCC)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H9O3.3C4H9.Sn/c1-2-15-11-7-10(13)8-5-3-4-6-9(8)12(11)14;3*1-3-4-2;/h3-6H,2H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | LMBPKTGOUSAMSK-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.26 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|