About sulfane;bis(tributyl(phenyl)stannane)
sulfane;bis(tributyl(phenyl)stannane) (PubChem CID 67835272) has the molecular formula C36H66SSn2
and a molecular weight of 768.41 g/mol. Its IUPAC name is sulfane;bis(tributyl(phenyl)stannane).
Molecular Properties
| Compound Name | sulfane;bis(tributyl(phenyl)stannane) |
| PubChem CID | 67835272 |
| Molecular Formula | C36H66SSn2 |
| Molecular Weight | 768.41 g/mol |
| Exact Mass | 770.29 |
| IUPAC Name | sulfane;bis(tributyl(phenyl)stannane) |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccccc1.CCCC[Sn](CCCC)(CCCC)c1ccccc1.S |
| InChI | InChI=1S/2C6H5.6C4H9.H2S.2Sn/c2*1-2-4-6-5-3-1;6*1-3-4-2;;;/h2*1-5H;6*1,3-4H2,2H3;1H2;; |
| InChIKey | LMEMYXUWCOCCJE-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 768.41 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze sulfane;bis(tributyl(phenyl)stannane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;bis(tributyl(phenyl)stannane)?
The IUPAC name of sulfane;bis(tributyl(phenyl)stannane) (CID 67835272) is sulfane;bis(tributyl(phenyl)stannane).
What is the SMILES notation for sulfane;bis(tributyl(phenyl)stannane)?
The canonical SMILES for sulfane;bis(tributyl(phenyl)stannane) is CCCC[Sn](CCCC)(CCCC)c1ccccc1.CCCC[Sn](CCCC)(CCCC)c1ccccc1.S.
What is the InChIKey of sulfane;bis(tributyl(phenyl)stannane)?
The InChIKey is LMEMYXUWCOCCJE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5.6C4H9.H2S.2Sn/c2*1-2-4-6-5-3-1;6*1-3-4-2;;;/h2*1-5H;6*1,3-4H2,2H3;1H2;;.
What are the key properties of sulfane;bis(tributyl(phenyl)stannane)?
sulfane;bis(tributyl(phenyl)stannane) has a molecular weight of 768.41 g/mol, XLogP of 11.60, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;bis(tributyl(phenyl)stannane) is sourced from PubChem (CID 67835272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).