C28H39NOSn — CID 152704451
N,N-diphenyl-5-tributylstannylfuran-2-amine (PubChem CID 152704451) has the molecular formula C28H39NOSn and a molecular weight of 524.34 g/mol. Its IUPAC name is N,N-diphenyl-5-tributylstannylfuran-2-amine.
| Compound Name | N,N-diphenyl-5-tributylstannylfuran-2-amine |
|---|---|
| PubChem CID | 152704451 |
| Molecular Formula | C28H39NOSn |
| Molecular Weight | 524.34 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N,N-diphenyl-5-tributylstannylfuran-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(N(c2ccccc2)c2ccccc2)o1 |
| InChI | InChI=1S/C16H12NO.3C4H9.Sn/c1-3-8-14(9-4-1)17(16-12-7-13-18-16)15-10-5-2-6-11-15;3*1-3-4-2;/h1-12H;3*1,3-4H2,2H3; |
| InChIKey | ZSGUHADXTWWXDB-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.34 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |