C36H43F3N2Sn — CID 140905985
N,N-diphenyl-3-[6-tributylstannyl-4-(trifluoromethyl)-2-pyridinyl]aniline (PubChem CID 140905985) has the molecular formula C36H43F3N2Sn and a molecular weight of 679.46 g/mol. Its IUPAC name is N,N-diphenyl-3-[6-tributylstannyl-4-(trifluoromethyl)-2-pyridinyl]aniline.
| Compound Name | N,N-diphenyl-3-[6-tributylstannyl-4-(trifluoromethyl)-2-pyridinyl]aniline |
|---|---|
| PubChem CID | 140905985 |
| Molecular Formula | C36H43F3N2Sn |
| Molecular Weight | 679.46 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | N,N-diphenyl-3-[6-tributylstannyl-4-(trifluoromethyl)-2-pyridinyl]aniline |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(C(F)(F)F)cc(-c2cccc(N(c3ccccc3)c3ccccc3)c2)n1 |
| InChI | InChI=1S/C24H16F3N2.3C4H9.Sn/c25-24(26,27)19-14-15-28-23(17-19)18-8-7-13-22(16-18)29(20-9-3-1-4-10-20)21-11-5-2-6-12-21;3*1-3-4-2;/h1-14,16-17H;3*1,3-4H2,2H3; |
| InChIKey | GKXUBPBEJRRVIK-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.46 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |