About fluoro(triphenyl)stannane;tributyl(fluoro)stannane
fluoro(triphenyl)stannane;tributyl(fluoro)stannane (PubChem CID 160888992) has the molecular formula C30H42F2Sn2
and a molecular weight of 678.08 g/mol. Its IUPAC name is fluoro(triphenyl)stannane;tributyl(fluoro)stannane.
Molecular Properties
| Compound Name | fluoro(triphenyl)stannane;tributyl(fluoro)stannane |
| PubChem CID | 160888992 |
| Molecular Formula | C30H42F2Sn2 |
| Molecular Weight | 678.08 g/mol |
| Exact Mass | 680.13 |
| IUPAC Name | fluoro(triphenyl)stannane;tributyl(fluoro)stannane |
| SMILES | CCCC[Sn](F)(CCCC)CCCC.F[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/3C6H5.3C4H9.2FH.2Sn/c3*1-2-4-6-5-3-1;3*1-3-4-2;;;;/h3*1-5H;3*1,3-4H2,2H3;2*1H;;/q;;;;;;;;2*+1/p-2 |
| InChIKey | SNZXPJNQPOTWJD-UHFFFAOYSA-L |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.08 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoro(triphenyl)stannane;tributyl(fluoro)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(triphenyl)stannane;tributyl(fluoro)stannane?
The IUPAC name of fluoro(triphenyl)stannane;tributyl(fluoro)stannane (CID 160888992) is fluoro(triphenyl)stannane;tributyl(fluoro)stannane.
What is the SMILES notation for fluoro(triphenyl)stannane;tributyl(fluoro)stannane?
The canonical SMILES for fluoro(triphenyl)stannane;tributyl(fluoro)stannane is CCCC[Sn](F)(CCCC)CCCC.F[Sn](c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of fluoro(triphenyl)stannane;tributyl(fluoro)stannane?
The InChIKey is SNZXPJNQPOTWJD-UHFFFAOYSA-L. The full InChI is InChI=1S/3C6H5.3C4H9.2FH.2Sn/c3*1-2-4-6-5-3-1;3*1-3-4-2;;;;/h3*1-5H;3*1,3-4H2,2H3;2*1H;;/q;;;;;;;;2*+1/p-2.
What are the key properties of fluoro(triphenyl)stannane;tributyl(fluoro)stannane?
fluoro(triphenyl)stannane;tributyl(fluoro)stannane has a molecular weight of 678.08 g/mol, XLogP of 7.92, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(triphenyl)stannane;tributyl(fluoro)stannane is sourced from PubChem (CID 160888992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).