About 2-prop-2-enylpyridine;tributyl(fluoro)stannane
2-prop-2-enylpyridine;tributyl(fluoro)stannane (PubChem CID 174480224) has the molecular formula C20H36FNSn
and a molecular weight of 428.22 g/mol. Its IUPAC name is 2-prop-2-enylpyridine;tributyl(fluoro)stannane.
Molecular Properties
| Compound Name | 2-prop-2-enylpyridine;tributyl(fluoro)stannane |
| PubChem CID | 174480224 |
| Molecular Formula | C20H36FNSn |
| Molecular Weight | 428.22 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-prop-2-enylpyridine;tributyl(fluoro)stannane |
| SMILES | C=CCc1ccccn1.CCCC[Sn](F)(CCCC)CCCC |
| InChI | InChI=1S/C8H9N.3C4H9.FH.Sn/c1-2-5-8-6-3-4-7-9-8;3*1-3-4-2;;/h2-4,6-7H,1,5H2;3*1,3-4H2,2H3;1H;/q;;;;;+1/p-1 |
| InChIKey | IVVQUODIXUQDJZ-UHFFFAOYSA-M |
| XLogP | 7.11 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.22 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylpyridine;tributyl(fluoro)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylpyridine;tributyl(fluoro)stannane?
The IUPAC name of 2-prop-2-enylpyridine;tributyl(fluoro)stannane (CID 174480224) is 2-prop-2-enylpyridine;tributyl(fluoro)stannane.
What is the SMILES notation for 2-prop-2-enylpyridine;tributyl(fluoro)stannane?
The canonical SMILES for 2-prop-2-enylpyridine;tributyl(fluoro)stannane is C=CCc1ccccn1.CCCC[Sn](F)(CCCC)CCCC.
What is the InChIKey of 2-prop-2-enylpyridine;tributyl(fluoro)stannane?
The InChIKey is IVVQUODIXUQDJZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9N.3C4H9.FH.Sn/c1-2-5-8-6-3-4-7-9-8;3*1-3-4-2;;/h2-4,6-7H,1,5H2;3*1,3-4H2,2H3;1H;/q;;;;;+1/p-1.
What are the key properties of 2-prop-2-enylpyridine;tributyl(fluoro)stannane?
2-prop-2-enylpyridine;tributyl(fluoro)stannane has a molecular weight of 428.22 g/mol, XLogP of 7.11, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylpyridine;tributyl(fluoro)stannane is sourced from PubChem (CID 174480224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).