C20H32F2Sn — CID 24824295
tributyl-(2,2-difluoro-1-phenylethenyl)stannane (PubChem CID 24824295) has the molecular formula C20H32F2Sn and a molecular weight of 429.18 g/mol. Its IUPAC name is tributyl-(2,2-difluoro-1-phenylethenyl)stannane.
| Compound Name | tributyl-(2,2-difluoro-1-phenylethenyl)stannane |
|---|---|
| PubChem CID | 24824295 |
| Molecular Formula | C20H32F2Sn |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | tributyl-(2,2-difluoro-1-phenylethenyl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C(=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C8H5F2.3C4H9.Sn/c9-8(10)6-7-4-2-1-3-5-7;3*1-3-4-2;/h1-5H;3*1,3-4H2,2H3; |
| InChIKey | QTKPXQSNYUVBDC-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |