C23H33F3Sn — CID 177486303
tributyl-[(Z)-5,5,5-trifluoro-2-phenylpent-1-en-3-ynyl]stannane (PubChem CID 177486303) has the molecular formula C23H33F3Sn and a molecular weight of 485.22 g/mol. Its IUPAC name is tributyl-[(Z)-5,5,5-trifluoro-2-phenylpent-1-en-3-ynyl]stannane.
| Compound Name | tributyl-[(Z)-5,5,5-trifluoro-2-phenylpent-1-en-3-ynyl]stannane |
|---|---|
| PubChem CID | 177486303 |
| Molecular Formula | C23H33F3Sn |
| Molecular Weight | 485.22 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | tributyl-[(Z)-5,5,5-trifluoro-2-phenylpent-1-en-3-ynyl]stannane |
| SMILES | CCCC[Sn](/C=C(\C#CC(F)(F)F)c1ccccc1)(CCCC)CCCC |
| InChI | InChI=1S/C11H6F3.3C4H9.Sn/c1-9(7-8-11(12,13)14)10-5-3-2-4-6-10;3*1-3-4-2;/h1-6H;3*1,3-4H2,2H3; |
| InChIKey | NPTQWVKEUZCPLD-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.22 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|