About tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane
tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane (PubChem CID 171932376) has the molecular formula C29H37F3Sn
and a molecular weight of 561.32 g/mol. Its IUPAC name is tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane.
Molecular Properties
| Compound Name | tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane |
| PubChem CID | 171932376 |
| Molecular Formula | C29H37F3Sn |
| Molecular Weight | 561.32 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane |
| SMILES | CCCC[Sn](/C=C(\C#CC(F)(F)F)c1ccc(-c2ccccc2)cc1)(CCCC)CCCC |
| InChI | InChI=1S/C17H10F3.3C4H9.Sn/c1-13(11-12-17(18,19)20)14-7-9-16(10-8-14)15-5-3-2-4-6-15;3*1-3-4-2;/h1-10H;3*1,3-4H2,2H3; |
| InChIKey | KTAZEIIHEBTCNE-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.32 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane?
The IUPAC name of tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane (CID 171932376) is tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane.
What is the SMILES notation for tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane?
The canonical SMILES for tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane is CCCC[Sn](/C=C(\C#CC(F)(F)F)c1ccc(-c2ccccc2)cc1)(CCCC)CCCC.
What is the InChIKey of tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane?
The InChIKey is KTAZEIIHEBTCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F3.3C4H9.Sn/c1-13(11-12-17(18,19)20)14-7-9-16(10-8-14)15-5-3-2-4-6-15;3*1-3-4-2;/h1-10H;3*1,3-4H2,2H3;.
What are the key properties of tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane?
tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane has a molecular weight of 561.32 g/mol, XLogP of 9.69, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-[(Z)-5,5,5-trifluoro-2-(4-phenylphenyl)pent-1-en-3-ynyl]stannane is sourced from PubChem (CID 171932376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).