About 1-fluoronona-1,2-dienylbenzene
1-fluoronona-1,2-dienylbenzene (PubChem CID 174565883) has the molecular formula C15H19F
and a molecular weight of 218.32 g/mol. Its IUPAC name is 1-fluoronona-1,2-dienylbenzene.
Molecular Properties
| Compound Name | 1-fluoronona-1,2-dienylbenzene |
| PubChem CID | 174565883 |
| Molecular Formula | C15H19F |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 1-fluoronona-1,2-dienylbenzene |
| SMILES | CCCCCCC=C=C(F)c1ccccc1 |
| InChI | InChI=1S/C15H19F/c1-2-3-4-5-6-10-13-15(16)14-11-8-7-9-12-14/h7-12H,2-6H2,1H3 |
| InChIKey | CNFYSOPTYTXWMJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoronona-1,2-dienylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoronona-1,2-dienylbenzene?
The IUPAC name of 1-fluoronona-1,2-dienylbenzene (CID 174565883) is 1-fluoronona-1,2-dienylbenzene.
What is the SMILES notation for 1-fluoronona-1,2-dienylbenzene?
The canonical SMILES for 1-fluoronona-1,2-dienylbenzene is CCCCCCC=C=C(F)c1ccccc1.
What is the InChIKey of 1-fluoronona-1,2-dienylbenzene?
The InChIKey is CNFYSOPTYTXWMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F/c1-2-3-4-5-6-10-13-15(16)14-11-8-7-9-12-14/h7-12H,2-6H2,1H3.
What are the key properties of 1-fluoronona-1,2-dienylbenzene?
1-fluoronona-1,2-dienylbenzene has a molecular weight of 218.32 g/mol, XLogP of 5.12, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoronona-1,2-dienylbenzene is sourced from PubChem (CID 174565883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).