C15H20 — CID 42604070
2-methylocta-2,3-dienylbenzene (PubChem CID 42604070) has the molecular formula C15H20 and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-methylocta-2,3-dienylbenzene.
| Compound Name | 2-methylocta-2,3-dienylbenzene |
|---|---|
| PubChem CID | 42604070 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-methylocta-2,3-dienylbenzene |
| SMILES | CCCCC=C=C(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H20/c1-3-4-5-7-10-14(2)13-15-11-8-6-9-12-15/h6-9,11-12H,3-5,13H2,1-2H3 |
| InChIKey | QWYAQKUUBKWYIZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|