C12H13F — CID 162374144
5-fluorohexa-3,4-dienylbenzene (PubChem CID 162374144) has the molecular formula C12H13F and a molecular weight of 176.23 g/mol. Its IUPAC name is 5-fluorohexa-3,4-dienylbenzene.
| Compound Name | 5-fluorohexa-3,4-dienylbenzene |
|---|---|
| PubChem CID | 162374144 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 5-fluorohexa-3,4-dienylbenzene |
| SMILES | CC(F)=C=CCCc1ccccc1 |
| InChI | InChI=1S/C12H13F/c1-11(13)7-5-6-10-12-8-3-2-4-9-12/h2-5,8-9H,6,10H2,1H3 |
| InChIKey | DZZDECXQHJIWDF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |