C21H22 — CID 102158622
(5-benzyl-6-methylhepta-3,4,6-trienyl)benzene (PubChem CID 102158622) has the molecular formula C21H22 and a molecular weight of 274.41 g/mol. Its IUPAC name is (5-benzyl-6-methylhepta-3,4,6-trienyl)benzene.
| Compound Name | (5-benzyl-6-methylhepta-3,4,6-trienyl)benzene |
|---|---|
| PubChem CID | 102158622 |
| Molecular Formula | C21H22 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (5-benzyl-6-methylhepta-3,4,6-trienyl)benzene |
| SMILES | C=C(C)C(=C=CCCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H22/c1-18(2)21(17-20-14-7-4-8-15-20)16-10-9-13-19-11-5-3-6-12-19/h3-8,10-12,14-15H,1,9,13,17H2,2H3 |
| InChIKey | YBMOLFPPAHNTGG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|