About [(4Z)-8-methylnona-4,8-dienyl]benzene
[(4Z)-8-methylnona-4,8-dienyl]benzene (PubChem CID 10775019) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is [(4Z)-8-methylnona-4,8-dienyl]benzene.
Molecular Properties
| Compound Name | [(4Z)-8-methylnona-4,8-dienyl]benzene |
| PubChem CID | 10775019 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | [(4Z)-8-methylnona-4,8-dienyl]benzene |
| SMILES | C=C(C)CC/C=C\CCCc1ccccc1 |
| InChI | InChI=1S/C16H22/c1-15(2)11-7-4-3-5-8-12-16-13-9-6-10-14-16/h3-4,6,9-10,13-14H,1,5,7-8,11-12H2,2H3/b4-3- |
| InChIKey | SLLKQULMQSVVCS-ARJAWSKDSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-8-methylnona-4,8-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-8-methylnona-4,8-dienyl]benzene?
The IUPAC name of [(4Z)-8-methylnona-4,8-dienyl]benzene (CID 10775019) is [(4Z)-8-methylnona-4,8-dienyl]benzene.
What is the SMILES notation for [(4Z)-8-methylnona-4,8-dienyl]benzene?
The canonical SMILES for [(4Z)-8-methylnona-4,8-dienyl]benzene is C=C(C)CC/C=C\CCCc1ccccc1.
What is the InChIKey of [(4Z)-8-methylnona-4,8-dienyl]benzene?
The InChIKey is SLLKQULMQSVVCS-ARJAWSKDSA-N. The full InChI is InChI=1S/C16H22/c1-15(2)11-7-4-3-5-8-12-16-13-9-6-10-14-16/h3-4,6,9-10,13-14H,1,5,7-8,11-12H2,2H3/b4-3-.
What are the key properties of [(4Z)-8-methylnona-4,8-dienyl]benzene?
[(4Z)-8-methylnona-4,8-dienyl]benzene has a molecular weight of 214.35 g/mol, XLogP of 4.92, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-8-methylnona-4,8-dienyl]benzene is sourced from PubChem (CID 10775019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).