C16H22 — CID 10775019
[(4Z)-8-methylnona-4,8-dienyl]benzene (PubChem CID 10775019) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is [(4Z)-8-methylnona-4,8-dienyl]benzene.
| Compound Name | [(4Z)-8-methylnona-4,8-dienyl]benzene |
|---|---|
| PubChem CID | 10775019 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | [(4Z)-8-methylnona-4,8-dienyl]benzene |
| SMILES | C=C(C)CC/C=C\CCCc1ccccc1 |
| InChI | InChI=1S/C16H22/c1-15(2)11-7-4-3-5-8-12-16-13-9-6-10-14-16/h3-4,6,9-10,13-14H,1,5,7-8,11-12H2,2H3/b4-3- |
| InChIKey | SLLKQULMQSVVCS-ARJAWSKDSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|