About but-2-enylbenzene;3-methylbut-3-enylbenzene
but-2-enylbenzene;3-methylbut-3-enylbenzene (PubChem CID 157229371) has the molecular formula C21H26
and a molecular weight of 278.44 g/mol. Its IUPAC name is but-2-enylbenzene;3-methylbut-3-enylbenzene.
Molecular Properties
| Compound Name | but-2-enylbenzene;3-methylbut-3-enylbenzene |
| PubChem CID | 157229371 |
| Molecular Formula | C21H26 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | but-2-enylbenzene;3-methylbut-3-enylbenzene |
| SMILES | C=C(C)CCc1ccccc1.CC=CCc1ccccc1 |
| InChI | InChI=1S/C11H14.C10H12/c1-10(2)8-9-11-6-4-3-5-7-11;1-2-3-7-10-8-5-4-6-9-10/h3-7H,1,8-9H2,2H3;2-6,8-9H,7H2,1H3 |
| InChIKey | ATXRTBTURRTFCP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-enylbenzene;3-methylbut-3-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enylbenzene;3-methylbut-3-enylbenzene?
The IUPAC name of but-2-enylbenzene;3-methylbut-3-enylbenzene (CID 157229371) is but-2-enylbenzene;3-methylbut-3-enylbenzene.
What is the SMILES notation for but-2-enylbenzene;3-methylbut-3-enylbenzene?
The canonical SMILES for but-2-enylbenzene;3-methylbut-3-enylbenzene is C=C(C)CCc1ccccc1.CC=CCc1ccccc1.
What is the InChIKey of but-2-enylbenzene;3-methylbut-3-enylbenzene?
The InChIKey is ATXRTBTURRTFCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.C10H12/c1-10(2)8-9-11-6-4-3-5-7-11;1-2-3-7-10-8-5-4-6-9-10/h3-7H,1,8-9H2,2H3;2-6,8-9H,7H2,1H3.
What are the key properties of but-2-enylbenzene;3-methylbut-3-enylbenzene?
but-2-enylbenzene;3-methylbut-3-enylbenzene has a molecular weight of 278.44 g/mol, XLogP of 6.00, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enylbenzene;3-methylbut-3-enylbenzene is sourced from PubChem (CID 157229371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).