About 2-(fluoromethylidene)hexylbenzene;silane
2-(fluoromethylidene)hexylbenzene;silane (PubChem CID 161077647) has the molecular formula C13H21FSi
and a molecular weight of 224.40 g/mol. Its IUPAC name is 2-(fluoromethylidene)hexylbenzene;silane.
Molecular Properties
| Compound Name | 2-(fluoromethylidene)hexylbenzene;silane |
| PubChem CID | 161077647 |
| Molecular Formula | C13H21FSi |
| Molecular Weight | 224.40 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-(fluoromethylidene)hexylbenzene;silane |
| SMILES | CCCCC(=CF)Cc1ccccc1.[SiH4] |
| InChI | InChI=1S/C13H17F.H4Si/c1-2-3-7-13(11-14)10-12-8-5-4-6-9-12;/h4-6,8-9,11H,2-3,7,10H2,1H3;1H4 |
| InChIKey | UFMLWWIVWNVIHE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-(fluoromethylidene)hexylbenzene;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethylidene)hexylbenzene;silane?
The IUPAC name of 2-(fluoromethylidene)hexylbenzene;silane (CID 161077647) is 2-(fluoromethylidene)hexylbenzene;silane.
What is the SMILES notation for 2-(fluoromethylidene)hexylbenzene;silane?
The canonical SMILES for 2-(fluoromethylidene)hexylbenzene;silane is CCCCC(=CF)Cc1ccccc1.[SiH4].
What is the InChIKey of 2-(fluoromethylidene)hexylbenzene;silane?
The InChIKey is UFMLWWIVWNVIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F.H4Si/c1-2-3-7-13(11-14)10-12-8-5-4-6-9-12;/h4-6,8-9,11H,2-3,7,10H2,1H3;1H4.
What are the key properties of 2-(fluoromethylidene)hexylbenzene;silane?
2-(fluoromethylidene)hexylbenzene;silane has a molecular weight of 224.40 g/mol, XLogP of 2.82, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethylidene)hexylbenzene;silane is sourced from PubChem (CID 161077647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).