About triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane
triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane (PubChem CID 46895399) has the molecular formula C24H38OSi
and a molecular weight of 370.65 g/mol. Its IUPAC name is triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane.
Molecular Properties
| Compound Name | triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane |
| PubChem CID | 46895399 |
| Molecular Formula | C24H38OSi |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane |
| SMILES | CCCCCCC=C=C(O[Si](CC)(CC)CC)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C24H38OSi/c1-6-10-11-12-13-17-20-24(25-26(7-2,8-3)9-4)22(5)21-23-18-15-14-16-19-23/h14-19,21H,6-13H2,1-5H3/b22-21+ |
| InChIKey | DOWOUGKISMGPJS-QURGRASLSA-N |
| XLogP | 8.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane?
The IUPAC name of triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane (CID 46895399) is triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane.
What is the SMILES notation for triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane?
The canonical SMILES for triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane is CCCCCCC=C=C(O[Si](CC)(CC)CC)/C(C)=C/c1ccccc1.
What is the InChIKey of triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane?
The InChIKey is DOWOUGKISMGPJS-QURGRASLSA-N. The full InChI is InChI=1S/C24H38OSi/c1-6-10-11-12-13-17-20-24(25-26(7-2,8-3)9-4)22(5)21-23-18-15-14-16-19-23/h14-19,21H,6-13H2,1-5H3/b22-21+.
What are the key properties of triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane?
triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane has a molecular weight of 370.65 g/mol, XLogP of 8.12, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane is sourced from PubChem (CID 46895399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).