C24H38OSi — CID 46895399
triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane (PubChem CID 46895399) has the molecular formula C24H38OSi and a molecular weight of 370.65 g/mol. Its IUPAC name is triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane.
| Compound Name | triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane |
|---|---|
| PubChem CID | 46895399 |
| Molecular Formula | C24H38OSi |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | triethyl-[(1E)-2-methyl-1-phenylundeca-1,3,4-trien-3-yl]oxysilane |
| SMILES | CCCCCCC=C=C(O[Si](CC)(CC)CC)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C24H38OSi/c1-6-10-11-12-13-17-20-24(25-26(7-2,8-3)9-4)22(5)21-23-18-15-14-16-19-23/h14-19,21H,6-13H2,1-5H3/b22-21+ |
| InChIKey | DOWOUGKISMGPJS-QURGRASLSA-N |
| XLogP | 8.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|