C17H30OSi2 — CID 11722715
triethyl-[(Z)-2-phenyl-1-trimethylsilylethenoxy]silane (PubChem CID 11722715) has the molecular formula C17H30OSi2 and a molecular weight of 306.60 g/mol. Its IUPAC name is triethyl-[(Z)-2-phenyl-1-trimethylsilylethenoxy]silane.
| Compound Name | triethyl-[(Z)-2-phenyl-1-trimethylsilylethenoxy]silane |
|---|---|
| PubChem CID | 11722715 |
| Molecular Formula | C17H30OSi2 |
| Molecular Weight | 306.60 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | triethyl-[(Z)-2-phenyl-1-trimethylsilylethenoxy]silane |
| SMILES | CC[Si](CC)(CC)O/C(=C/c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C17H30OSi2/c1-7-20(8-2,9-3)18-17(19(4,5)6)15-16-13-11-10-12-14-16/h10-15H,7-9H2,1-6H3/b17-15- |
| InChIKey | GFONXCBAELIELD-ICFOKQHNSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.60 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|